C32H30N2O — CID 23636072
(1S,2S,10S,13S)-10-methyl-7-phenyl-5-pyridin-2-yl-6-azapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-4,6,8,14(19),15,17-hexaen-17-ol (PubChem CID 23636072) has the molecular formula C32H30N2O and a molecular weight of 458.61 g/mol. Its IUPAC name is (1S,2S,10S,13S)-10-methyl-7-phenyl-5-pyridin-2-yl-6-azapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-4,6,8,14(19),15,17-hexaen-17-ol.
| Compound Name | (1S,2S,10S,13S)-10-methyl-7-phenyl-5-pyridin-2-yl-6-azapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-4,6,8,14(19),15,17-hexaen-17-ol |
|---|---|
| PubChem CID | 23636072 |
| Molecular Formula | C32H30N2O |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (1S,2S,10S,13S)-10-methyl-7-phenyl-5-pyridin-2-yl-6-azapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-4,6,8,14(19),15,17-hexaen-17-ol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1Cc1c2cc(-c2ccccc2)nc1-c1ccccn1 |
| InChI | InChI=1S/C32H30N2O/c1-32-15-14-24-23-13-11-22(35)17-21(23)10-12-25(24)27(32)18-26-28(32)19-30(20-7-3-2-4-8-20)34-31(26)29-9-5-6-16-33-29/h2-9,11,13,16-17,19,24-25,27,35H,10,12,14-15,18H2,1H3/t24-,25-,27+,32+/m1/s1 |
| InChIKey | WZVREKXBNFOIFC-FCNKXXAYSA-N |
| XLogP | 7.09 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |