C20H34BrNO — CID 23636116
6-(decylamino)-5,6,7,8-tetrahydronaphthalen-1-ol;hydrobromide (PubChem CID 23636116) has the molecular formula C20H34BrNO and a molecular weight of 384.40 g/mol. Its IUPAC name is 6-(decylamino)-5,6,7,8-tetrahydronaphthalen-1-ol;hydrobromide.
| Compound Name | 6-(decylamino)-5,6,7,8-tetrahydronaphthalen-1-ol;hydrobromide |
|---|---|
| PubChem CID | 23636116 |
| Molecular Formula | C20H34BrNO |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 6-(decylamino)-5,6,7,8-tetrahydronaphthalen-1-ol;hydrobromide |
| SMILES | Br.CCCCCCCCCCNC1CCc2c(O)cccc2C1 |
| InChI | InChI=1S/C20H33NO.BrH/c1-2-3-4-5-6-7-8-9-15-21-18-13-14-19-17(16-18)11-10-12-20(19)22;/h10-12,18,21-22H,2-9,13-16H2,1H3;1H |
| InChIKey | ZSILQPJRXGJMHZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|