C16H23NO2 — CID 23636177
(1S,2S,4R,8R)-8-butyl-2-prop-2-enyl-7-azatricyclo[5.3.0.04,8]decane-3,6-dione (PubChem CID 23636177) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is (1S,2S,4R,8R)-8-butyl-2-prop-2-enyl-7-azatricyclo[5.3.0.04,8]decane-3,6-dione.
| Compound Name | (1S,2S,4R,8R)-8-butyl-2-prop-2-enyl-7-azatricyclo[5.3.0.04,8]decane-3,6-dione |
|---|---|
| PubChem CID | 23636177 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (1S,2S,4R,8R)-8-butyl-2-prop-2-enyl-7-azatricyclo[5.3.0.04,8]decane-3,6-dione |
| SMILES | C=CC[C@@H]1C(=O)[C@@H]2CC(=O)N3[C@H]1CC[C@]23CCCC |
| InChI | InChI=1S/C16H23NO2/c1-3-5-8-16-9-7-13-11(6-4-2)15(19)12(16)10-14(18)17(13)16/h4,11-13H,2-3,5-10H2,1H3/t11-,12-,13-,16+/m0/s1 |
| InChIKey | VLWYZYQROWFECP-WFGGJUAMSA-N |
| XLogP | 2.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|