C18H22ClNO2 — CID 23636355
7-methoxy-N-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride (PubChem CID 23636355) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is 7-methoxy-N-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride.
| Compound Name | 7-methoxy-N-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 23636355 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 7-methoxy-N-(4-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride |
| SMILES | COc1ccc(NC2CCc3ccc(OC)cc3C2)cc1.Cl |
| InChI | InChI=1S/C18H21NO2.ClH/c1-20-17-9-6-15(7-10-17)19-16-5-3-13-4-8-18(21-2)12-14(13)11-16;/h4,6-10,12,16,19H,3,5,11H2,1-2H3;1H |
| InChIKey | DDGJYFVHWNXJFE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|