About (1Z,4Z,6Z)-3-benzazocine
(1Z,4Z,6Z)-3-benzazocine (PubChem CID 23636835) has the molecular formula C11H9N
and a molecular weight of 155.20 g/mol. Its IUPAC name is (1Z,4Z,6Z)-3-benzazocine.
Molecular Properties
| Compound Name | (1Z,4Z,6Z)-3-benzazocine |
| PubChem CID | 23636835 |
| Molecular Formula | C11H9N |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | (1Z,4Z,6Z)-3-benzazocine |
| SMILES | C1=C\N=C/C=c2/cccc/c2=C/1 |
| InChI | InChI=1S/C11H9N/c1-2-5-11-7-9-12-8-3-6-10(11)4-1/h1-9H/b6-3-,8-3-,9-7-,10-6-,11-7-,12-8-,12-9- |
| InChIKey | DMGLUDJTJZXMMG-SLVRTNKRSA-N |
| XLogP | 0.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1Z,4Z,6Z)-3-benzazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,4Z,6Z)-3-benzazocine?
The IUPAC name of (1Z,4Z,6Z)-3-benzazocine (CID 23636835) is (1Z,4Z,6Z)-3-benzazocine.
What is the SMILES notation for (1Z,4Z,6Z)-3-benzazocine?
The canonical SMILES for (1Z,4Z,6Z)-3-benzazocine is C1=C\N=C/C=c2/cccc/c2=C/1.
What is the InChIKey of (1Z,4Z,6Z)-3-benzazocine?
The InChIKey is DMGLUDJTJZXMMG-SLVRTNKRSA-N. The full InChI is InChI=1S/C11H9N/c1-2-5-11-7-9-12-8-3-6-10(11)4-1/h1-9H/b6-3-,8-3-,9-7-,10-6-,11-7-,12-8-,12-9-.
What are the key properties of (1Z,4Z,6Z)-3-benzazocine?
(1Z,4Z,6Z)-3-benzazocine has a molecular weight of 155.20 g/mol, XLogP of 0.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,4Z,6Z)-3-benzazocine is sourced from PubChem (CID 23636835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).