About carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium
carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium (PubChem CID 23638714) has the molecular formula C5H7NWY-2
and a molecular weight of 353.86 g/mol. Its IUPAC name is carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium.
Molecular Properties
| Compound Name | carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium |
| PubChem CID | 23638714 |
| Molecular Formula | C5H7NWY-2 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.92 |
| IUPAC Name | carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium |
| SMILES | [CH3-].[H]/[C-]=N/C=C\C=[W].[Y] |
| InChI | InChI=1S/C4H4N.CH3.W.Y/c1-3-4-5-2;;;/h1-4H;1H3;;/q2*-1;;/b4-3-;;; |
| InChIKey | SEZBWWPCXWQIJH-FGSKAQBVSA-N |
| XLogP | 0.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium?
The IUPAC name of carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium (CID 23638714) is carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium.
What is the SMILES notation for carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium?
The canonical SMILES for carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium is [CH3-].[H]/[C-]=N/C=C\C=[W].[Y].
What is the InChIKey of carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium?
The InChIKey is SEZBWWPCXWQIJH-FGSKAQBVSA-N. The full InChI is InChI=1S/C4H4N.CH3.W.Y/c1-3-4-5-2;;;/h1-4H;1H3;;/q2*-1;;/b4-3-;;;.
What are the key properties of carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium?
carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium has a molecular weight of 353.86 g/mol, XLogP of 0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;[(Z)-3-(methanidylideneamino)prop-2-enylidene]tungsten;yttrium is sourced from PubChem (CID 23638714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).