C16H21N3O2 — CID 2364025
N'-[1-(4-morpholin-4-ylphenyl)ethenyl]cyclopropanecarbohydrazide (PubChem CID 2364025) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N'-[1-(4-morpholin-4-ylphenyl)ethenyl]cyclopropanecarbohydrazide.
| Compound Name | N'-[1-(4-morpholin-4-ylphenyl)ethenyl]cyclopropanecarbohydrazide |
|---|---|
| PubChem CID | 2364025 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N'-[1-(4-morpholin-4-ylphenyl)ethenyl]cyclopropanecarbohydrazide |
| SMILES | C=C(NNC(=O)C1CC1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H21N3O2/c1-12(17-18-16(20)14-2-3-14)13-4-6-15(7-5-13)19-8-10-21-11-9-19/h4-7,14,17H,1-3,8-11H2,(H,18,20) |
| InChIKey | OTCGPPAFFMDJFC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|