About 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone
1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone (PubChem CID 23640760) has the molecular formula C15H20O5
and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone.
Molecular Properties
| Compound Name | 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone |
| PubChem CID | 23640760 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone |
| SMILES | COC(C[C@H]1O[C@@H]1C(=O)COCc1ccccc1)OC |
| InChI | InChI=1S/C15H20O5/c1-17-14(18-2)8-13-15(20-13)12(16)10-19-9-11-6-4-3-5-7-11/h3-7,13-15H,8-10H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | RJAOZECOXVGCNY-UKRRQHHQSA-N |
| XLogP | 1.55 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone?
The IUPAC name of 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone (CID 23640760) is 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone.
What is the SMILES notation for 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone?
The canonical SMILES for 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone is COC(C[C@H]1O[C@@H]1C(=O)COCc1ccccc1)OC.
What is the InChIKey of 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone?
The InChIKey is RJAOZECOXVGCNY-UKRRQHHQSA-N. The full InChI is InChI=1S/C15H20O5/c1-17-14(18-2)8-13-15(20-13)12(16)10-19-9-11-6-4-3-5-7-11/h3-7,13-15H,8-10H2,1-2H3/t13-,15-/m1/s1.
What are the key properties of 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone?
1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone has a molecular weight of 280.32 g/mol, XLogP of 1.55, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,3R)-3-(2,2-dimethoxyethyl)oxiran-2-yl]-2-phenylmethoxyethanone is sourced from PubChem (CID 23640760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).