C27H34N4O2 — CID 23640764
(E)-N-[2-[(3R,6S)-3-benzyl-6-[(4-methoxyphenyl)methyl]-2,3,5,6-tetrahydroimidazo[1,2-a]imidazol-7-yl]ethyl]-2-methylbut-2-enamide (PubChem CID 23640764) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is (E)-N-[2-[(3R,6S)-3-benzyl-6-[(4-methoxyphenyl)methyl]-2,3,5,6-tetrahydroimidazo[1,2-a]imidazol-7-yl]ethyl]-2-methylbut-2-enamide.
| Compound Name | (E)-N-[2-[(3R,6S)-3-benzyl-6-[(4-methoxyphenyl)methyl]-2,3,5,6-tetrahydroimidazo[1,2-a]imidazol-7-yl]ethyl]-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 23640764 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (E)-N-[2-[(3R,6S)-3-benzyl-6-[(4-methoxyphenyl)methyl]-2,3,5,6-tetrahydroimidazo[1,2-a]imidazol-7-yl]ethyl]-2-methylbut-2-enamide |
| SMILES | C/C=C(\C)C(=O)NCCN1C2=NC[C@@H](Cc3ccccc3)N2C[C@@H]1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H34N4O2/c1-4-20(2)26(32)28-14-15-30-24(17-22-10-12-25(33-3)13-11-22)19-31-23(18-29-27(30)31)16-21-8-6-5-7-9-21/h4-13,23-24H,14-19H2,1-3H3,(H,28,32)/b20-4+/t23-,24+/m1/s1 |
| InChIKey | SRVIMZJNCBNYKP-XDPOPXRSSA-N |
| XLogP | 3.29 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|