C22H31N3O3S — CID 23640766
4-N,5-N-dibutyl-3-[(3,5-dimethylphenyl)sulfanylmethyl]-1,2-oxazole-4,5-dicarboxamide (PubChem CID 23640766) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is 4-N,5-N-dibutyl-3-[(3,5-dimethylphenyl)sulfanylmethyl]-1,2-oxazole-4,5-dicarboxamide.
| Compound Name | 4-N,5-N-dibutyl-3-[(3,5-dimethylphenyl)sulfanylmethyl]-1,2-oxazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 23640766 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 4-N,5-N-dibutyl-3-[(3,5-dimethylphenyl)sulfanylmethyl]-1,2-oxazole-4,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1onc(CSc2cc(C)cc(C)c2)c1C(=O)NCCCC |
| InChI | InChI=1S/C22H31N3O3S/c1-5-7-9-23-21(26)19-18(14-29-17-12-15(3)11-16(4)13-17)25-28-20(19)22(27)24-10-8-6-2/h11-13H,5-10,14H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | MQPVZQCECCHXDC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|