C23H31F6N3O2 — CID 23640770
3-[3,5-bis(trifluoromethyl)phenyl]-N-[3-(dibutylamino)propyl]-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 23640770) has the molecular formula C23H31F6N3O2 and a molecular weight of 495.51 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-N-[3-(dibutylamino)propyl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-N-[3-(dibutylamino)propyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 23640770 |
| Molecular Formula | C23H31F6N3O2 |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-N-[3-(dibutylamino)propyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CCCCN(CCCC)CCCNC(=O)C1CC(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)=NO1 |
| InChI | InChI=1S/C23H31F6N3O2/c1-3-5-9-32(10-6-4-2)11-7-8-30-21(33)20-15-19(31-34-20)16-12-17(22(24,25)26)14-18(13-16)23(27,28)29/h12-14,20H,3-11,15H2,1-2H3,(H,30,33) |
| InChIKey | WCUHHEKXISTQOY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|