C14H15F3N2O3 — CID 23640773
N-(2-methoxyethyl)-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 23640773) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 23640773 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-(2-methoxyethyl)-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | COCCNC(=O)C1CC(c2ccc(C(F)(F)F)cc2)=NO1 |
| InChI | InChI=1S/C14H15F3N2O3/c1-21-7-6-18-13(20)12-8-11(19-22-12)9-2-4-10(5-3-9)14(15,16)17/h2-5,12H,6-8H2,1H3,(H,18,20) |
| InChIKey | FZDVYKVVUSTJLB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|