C14H21N3 — CID 23640807
(5S)-5-benzyl-1-butyl-4,5-dihydroimidazol-2-amine (PubChem CID 23640807) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (5S)-5-benzyl-1-butyl-4,5-dihydroimidazol-2-amine.
| Compound Name | (5S)-5-benzyl-1-butyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 23640807 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (5S)-5-benzyl-1-butyl-4,5-dihydroimidazol-2-amine |
| SMILES | CCCCN1C(N)=NC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C14H21N3/c1-2-3-9-17-13(11-16-14(17)15)10-12-7-5-4-6-8-12/h4-8,13H,2-3,9-11H2,1H3,(H2,15,16)/t13-/m0/s1 |
| InChIKey | HPZLGBFCHUVQNX-ZDUSSCGKSA-N |
| XLogP | 2.03 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |