About 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine
3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine (PubChem CID 23640812) has the molecular formula C16H10N2O
and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine.
Molecular Properties
| Compound Name | 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine |
| PubChem CID | 23640812 |
| Molecular Formula | C16H10N2O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine |
| SMILES | C#Cc1ccc2c(c1)COc1c3ccccc3nn1-2 |
| InChI | InChI=1S/C16H10N2O/c1-2-11-7-8-15-12(9-11)10-19-16-13-5-3-4-6-14(13)17-18(15)16/h1,3-9H,10H2 |
| InChIKey | UNBMUTBTGXBINN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine?
The IUPAC name of 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine (CID 23640812) is 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine.
What is the SMILES notation for 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine?
The canonical SMILES for 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine is C#Cc1ccc2c(c1)COc1c3ccccc3nn1-2.
What is the InChIKey of 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine?
The InChIKey is UNBMUTBTGXBINN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O/c1-2-11-7-8-15-12(9-11)10-19-16-13-5-3-4-6-14(13)17-18(15)16/h1,3-9H,10H2.
What are the key properties of 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine?
3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine has a molecular weight of 246.27 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynyl-5H-indazolo[2,3-a][3,1]benzoxazine is sourced from PubChem (CID 23640812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).