C26H26ClN3O5 — CID 23640999
(1S,2R,7S,8R)-10-tert-butyl-4-(3-chlorophenyl)-7-(4-methoxyphenyl)-2-methyl-4,6,10-triazatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone (PubChem CID 23640999) has the molecular formula C26H26ClN3O5 and a molecular weight of 495.96 g/mol. Its IUPAC name is (1S,2R,7S,8R)-10-tert-butyl-4-(3-chlorophenyl)-7-(4-methoxyphenyl)-2-methyl-4,6,10-triazatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone.
| Compound Name | (1S,2R,7S,8R)-10-tert-butyl-4-(3-chlorophenyl)-7-(4-methoxyphenyl)-2-methyl-4,6,10-triazatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 23640999 |
| Molecular Formula | C26H26ClN3O5 |
| Molecular Weight | 495.96 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | (1S,2R,7S,8R)-10-tert-butyl-4-(3-chlorophenyl)-7-(4-methoxyphenyl)-2-methyl-4,6,10-triazatricyclo[6.3.0.02,6]undecane-3,5,9,11-tetrone |
| SMILES | COc1ccc([C@@H]2[C@@H]3C(=O)N(C(C)(C)C)C(=O)[C@@H]3[C@]3(C)C(=O)N(c4cccc(Cl)c4)C(=O)N23)cc1 |
| InChI | InChI=1S/C26H26ClN3O5/c1-25(2,3)30-21(31)18-19(22(30)32)26(4)23(33)28(16-8-6-7-15(27)13-16)24(34)29(26)20(18)14-9-11-17(35-5)12-10-14/h6-13,18-20H,1-5H3/t18-,19-,20-,26-/m1/s1 |
| InChIKey | SYWPMSLZWCINRG-QIRMHMFVSA-N |
| XLogP | 4.03 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.96 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|