About 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol
4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol (PubChem CID 23641159) has the molecular formula C21H22F6N2O
and a molecular weight of 432.41 g/mol. Its IUPAC name is 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol.
Molecular Properties
| Compound Name | 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol |
| PubChem CID | 23641159 |
| Molecular Formula | C21H22F6N2O |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol |
| SMILES | Oc1ccc(C[C@@H]2CNCCN2CCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H22F6N2O/c22-20(23,24)16-9-15(10-17(12-16)21(25,26)27)5-7-29-8-6-28-13-18(29)11-14-1-3-19(30)4-2-14/h1-4,9-10,12,18,28,30H,5-8,11,13H2/t18-/m1/s1 |
| InChIKey | QJGNPINIOGAPKM-GOSISDBHSA-N |
| XLogP | 4.49 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol?
The IUPAC name of 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol (CID 23641159) is 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol.
What is the SMILES notation for 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol?
The canonical SMILES for 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol is Oc1ccc(C[C@@H]2CNCCN2CCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1.
What is the InChIKey of 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol?
The InChIKey is QJGNPINIOGAPKM-GOSISDBHSA-N. The full InChI is InChI=1S/C21H22F6N2O/c22-20(23,24)16-9-15(10-17(12-16)21(25,26)27)5-7-29-8-6-28-13-18(29)11-14-1-3-19(30)4-2-14/h1-4,9-10,12,18,28,30H,5-8,11,13H2/t18-/m1/s1.
What are the key properties of 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol?
4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol has a molecular weight of 432.41 g/mol, XLogP of 4.49, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2R)-1-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]piperazin-2-yl]methyl]phenol is sourced from PubChem (CID 23641159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).