About (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione
(6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione (PubChem CID 23641167) has the molecular formula C18H30N2O2
and a molecular weight of 306.45 g/mol. Its IUPAC name is (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione.
Molecular Properties
| Compound Name | (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione |
| PubChem CID | 23641167 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione |
| SMILES | O=C1NC[C@H](CC2CCCCC2)N(CC2CCCCC2)C1=O |
| InChI | InChI=1S/C18H30N2O2/c21-17-18(22)20(13-15-9-5-2-6-10-15)16(12-19-17)11-14-7-3-1-4-8-14/h14-16H,1-13H2,(H,19,21)/t16-/m0/s1 |
| InChIKey | NMYFVVLOGICRCZ-INIZCTEOSA-N |
| XLogP | 2.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione?
The IUPAC name of (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione (CID 23641167) is (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione.
What is the SMILES notation for (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione?
The canonical SMILES for (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione is O=C1NC[C@H](CC2CCCCC2)N(CC2CCCCC2)C1=O.
What is the InChIKey of (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione?
The InChIKey is NMYFVVLOGICRCZ-INIZCTEOSA-N. The full InChI is InChI=1S/C18H30N2O2/c21-17-18(22)20(13-15-9-5-2-6-10-15)16(12-19-17)11-14-7-3-1-4-8-14/h14-16H,1-13H2,(H,19,21)/t16-/m0/s1.
What are the key properties of (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione?
(6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione has a molecular weight of 306.45 g/mol, XLogP of 2.86, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1,6-bis(cyclohexylmethyl)piperazine-2,3-dione is sourced from PubChem (CID 23641167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).