About 2-methoxybenzenethiol
2-methoxybenzenethiol (PubChem CID 23642) has the molecular formula C7H8OS
and a molecular weight of 140.21 g/mol. Its IUPAC name is 2-methoxybenzenethiol.
Molecular Properties
| Compound Name | 2-methoxybenzenethiol |
| PubChem CID | 23642 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | 2-methoxybenzenethiol |
| SMILES | COc1ccccc1S |
| InChI | InChI=1S/C7H8OS/c1-8-6-4-2-3-5-7(6)9/h2-5,9H,1H3 |
| InChIKey | DSCJETUEDFKYGN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxybenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybenzenethiol?
The IUPAC name of 2-methoxybenzenethiol (CID 23642) is 2-methoxybenzenethiol.
What is the SMILES notation for 2-methoxybenzenethiol?
The canonical SMILES for 2-methoxybenzenethiol is COc1ccccc1S.
What is the InChIKey of 2-methoxybenzenethiol?
The InChIKey is DSCJETUEDFKYGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS/c1-8-6-4-2-3-5-7(6)9/h2-5,9H,1H3.
What are the key properties of 2-methoxybenzenethiol?
2-methoxybenzenethiol has a molecular weight of 140.21 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybenzenethiol is sourced from PubChem (CID 23642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).