C30H38N4O3 — CID 23642222
1-(3-hydroxypropyl)-3-[4-[[4-[(4-phenylmethoxyphenyl)methyl]-1,4-diazepan-1-yl]methyl]phenyl]urea (PubChem CID 23642222) has the molecular formula C30H38N4O3 and a molecular weight of 502.66 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-[4-[[4-[(4-phenylmethoxyphenyl)methyl]-1,4-diazepan-1-yl]methyl]phenyl]urea.
| Compound Name | 1-(3-hydroxypropyl)-3-[4-[[4-[(4-phenylmethoxyphenyl)methyl]-1,4-diazepan-1-yl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 23642222 |
| Molecular Formula | C30H38N4O3 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-[4-[[4-[(4-phenylmethoxyphenyl)methyl]-1,4-diazepan-1-yl]methyl]phenyl]urea |
| SMILES | O=C(NCCCO)Nc1ccc(CN2CCCN(Cc3ccc(OCc4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H38N4O3/c35-21-4-16-31-30(36)32-28-12-8-25(9-13-28)22-33-17-5-18-34(20-19-33)23-26-10-14-29(15-11-26)37-24-27-6-2-1-3-7-27/h1-3,6-15,35H,4-5,16-24H2,(H2,31,32,36) |
| InChIKey | ULKJRQNJLXDAOU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|