About [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate
[2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate (PubChem CID 2364238) has the molecular formula C24H20N2O3S
and a molecular weight of 416.50 g/mol. Its IUPAC name is [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate.
Molecular Properties
| Compound Name | [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate |
| PubChem CID | 2364238 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccccc2-c2nc3ccccc3s2)c(C)c1 |
| InChI | InChI=1S/C24H20N2O3S/c1-15-11-12-19(16(2)13-15)25-22(27)14-29-24(28)18-8-4-3-7-17(18)23-26-20-9-5-6-10-21(20)30-23/h3-13H,14H2,1-2H3,(H,25,27) |
| InChIKey | IJIXAIRHQVZOGL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate?
The IUPAC name of [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate (CID 2364238) is [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate.
What is the SMILES notation for [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate?
The canonical SMILES for [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate is Cc1ccc(NC(=O)COC(=O)c2ccccc2-c2nc3ccccc3s2)c(C)c1.
What is the InChIKey of [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate?
The InChIKey is IJIXAIRHQVZOGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O3S/c1-15-11-12-19(16(2)13-15)25-22(27)14-29-24(28)18-8-4-3-7-17(18)23-26-20-9-5-6-10-21(20)30-23/h3-13H,14H2,1-2H3,(H,25,27).
What are the key properties of [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate?
[2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate has a molecular weight of 416.50 g/mol, XLogP of 5.38, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dimethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate is sourced from PubChem (CID 2364238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).