C23H26O5 — CID 23642399
(E)-1-(1,8,9,10-tetramethoxy-3-methylanthracen-2-yl)but-2-en-1-ol (PubChem CID 23642399) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is (E)-1-(1,8,9,10-tetramethoxy-3-methylanthracen-2-yl)but-2-en-1-ol.
| Compound Name | (E)-1-(1,8,9,10-tetramethoxy-3-methylanthracen-2-yl)but-2-en-1-ol |
|---|---|
| PubChem CID | 23642399 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (E)-1-(1,8,9,10-tetramethoxy-3-methylanthracen-2-yl)but-2-en-1-ol |
| SMILES | C/C=C/C(O)c1c(C)cc2c(OC)c3cccc(OC)c3c(OC)c2c1OC |
| InChI | InChI=1S/C23H26O5/c1-7-9-16(24)18-13(2)12-15-20(22(18)27-5)23(28-6)19-14(21(15)26-4)10-8-11-17(19)25-3/h7-12,16,24H,1-6H3/b9-7+ |
| InChIKey | SPSDFAWZRJHYKJ-VQHVLOKHSA-N |
| XLogP | 4.95 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|