C19H31NO4 — CID 23642770
1-O-tert-butyl 4-O-ethyl 4-(cyclohexen-1-yl)piperidine-1,4-dicarboxylate (PubChem CID 23642770) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl 4-(cyclohexen-1-yl)piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-ethyl 4-(cyclohexen-1-yl)piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 23642770 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl 4-(cyclohexen-1-yl)piperidine-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C2=CCCCC2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H31NO4/c1-5-23-16(21)19(15-9-7-6-8-10-15)11-13-20(14-12-19)17(22)24-18(2,3)4/h9H,5-8,10-14H2,1-4H3 |
| InChIKey | VMOKCWPLHRRXPK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|