C20H26O5 — CID 23642773
(1S,9S,10S)-9-butanoyl-10-butoxy-1-methoxy-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one (PubChem CID 23642773) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (1S,9S,10S)-9-butanoyl-10-butoxy-1-methoxy-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one.
| Compound Name | (1S,9S,10S)-9-butanoyl-10-butoxy-1-methoxy-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 23642773 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1S,9S,10S)-9-butanoyl-10-butoxy-1-methoxy-12-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
| SMILES | CCCCO[C@H]1C[C@]2(OC)O[C@@]1(C(=O)CCC)C(=O)c1ccccc12 |
| InChI | InChI=1S/C20H26O5/c1-4-6-12-24-17-13-19(23-3)15-11-8-7-10-14(15)18(22)20(17,25-19)16(21)9-5-2/h7-8,10-11,17H,4-6,9,12-13H2,1-3H3/t17-,19-,20+/m0/s1 |
| InChIKey | CFILHDXLYXZGKL-YSIASYRMSA-N |
| XLogP | 3.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|