C42H51N3O9 — CID 23643015
(3S,6R,9S,12R,15S,18R)-3,9,15-tribenzyl-6,12,18-triethyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 23643015) has the molecular formula C42H51N3O9 and a molecular weight of 741.88 g/mol. Its IUPAC name is (3S,6R,9S,12R,15S,18R)-3,9,15-tribenzyl-6,12,18-triethyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | (3S,6R,9S,12R,15S,18R)-3,9,15-tribenzyl-6,12,18-triethyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 23643015 |
| Molecular Formula | C42H51N3O9 |
| Molecular Weight | 741.88 g/mol |
| Exact Mass | 741.36 |
| IUPAC Name | (3S,6R,9S,12R,15S,18R)-3,9,15-tribenzyl-6,12,18-triethyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | CC[C@H]1OC(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@@H](CC)OC(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@@H](CC)OC(=O)[C@H](Cc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C42H51N3O9/c1-7-34-37(46)43(4)32(26-29-21-15-11-16-22-29)41(50)53-36(9-3)39(48)45(6)33(27-30-23-17-12-18-24-30)42(51)54-35(8-2)38(47)44(5)31(40(49)52-34)25-28-19-13-10-14-20-28/h10-24,31-36H,7-9,25-27H2,1-6H3/t31-,32-,33-,34+,35+,36+/m0/s1 |
| InChIKey | FQKAHLJHUHFLAB-FRMKCVIWSA-N |
| XLogP | 4.17 |
| TPSA | 139.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.88 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|