C30H28N2O6 — CID 23643105
methyl 2-[(1R,4'R,5S,7R)-3-benzyl-2,2'-dioxo-4'-phenylspiro[6,8-dioxa-3-azabicyclo[3.2.1]octane-7,3'-azetidine]-1'-yl]-3-phenylpropanoate (PubChem CID 23643105) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is methyl 2-[(1R,4'R,5S,7R)-3-benzyl-2,2'-dioxo-4'-phenylspiro[6,8-dioxa-3-azabicyclo[3.2.1]octane-7,3'-azetidine]-1'-yl]-3-phenylpropanoate.
| Compound Name | methyl 2-[(1R,4'R,5S,7R)-3-benzyl-2,2'-dioxo-4'-phenylspiro[6,8-dioxa-3-azabicyclo[3.2.1]octane-7,3'-azetidine]-1'-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 23643105 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | methyl 2-[(1R,4'R,5S,7R)-3-benzyl-2,2'-dioxo-4'-phenylspiro[6,8-dioxa-3-azabicyclo[3.2.1]octane-7,3'-azetidine]-1'-yl]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)N1C(=O)[C@@]2(O[C@H]3CN(Cc4ccccc4)C(=O)[C@@H]2O3)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C30H28N2O6/c1-36-28(34)23(17-20-11-5-2-6-12-20)32-25(22-15-9-4-10-16-22)30(29(32)35)26-27(33)31(19-24(37-26)38-30)18-21-13-7-3-8-14-21/h2-16,23-26H,17-19H2,1H3/t23?,24-,25+,26-,30+/m0/s1 |
| InChIKey | FNXBTNAYEVMUAN-HPBWYRPCSA-N |
| XLogP | 2.88 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |