C20H30O7P2 — CID 23643216
[(2Z,6E)-7,11-dimethyl-3-phenyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate (PubChem CID 23643216) has the molecular formula C20H30O7P2 and a molecular weight of 444.40 g/mol. Its IUPAC name is [(2Z,6E)-7,11-dimethyl-3-phenyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate.
| Compound Name | [(2Z,6E)-7,11-dimethyl-3-phenyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 23643216 |
| Molecular Formula | C20H30O7P2 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [(2Z,6E)-7,11-dimethyl-3-phenyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C/COP(=O)(O)OP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C20H30O7P2/c1-17(2)9-7-10-18(3)11-8-14-20(19-12-5-4-6-13-19)15-16-26-29(24,25)27-28(21,22)23/h4-6,9,11-13,15H,7-8,10,14,16H2,1-3H3,(H,24,25)(H2,21,22,23)/b18-11+,20-15- |
| InChIKey | PSDPRIXDACWPPD-USYSLJQJSA-N |
| XLogP | 5.77 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|