C22H22F2N2O4 — CID 23643261
diethyl 1,3-bis(4-fluorophenyl)-2,4-dihydropyrimidine-5,6-dicarboxylate (PubChem CID 23643261) has the molecular formula C22H22F2N2O4 and a molecular weight of 416.42 g/mol. Its IUPAC name is diethyl 1,3-bis(4-fluorophenyl)-2,4-dihydropyrimidine-5,6-dicarboxylate.
| Compound Name | diethyl 1,3-bis(4-fluorophenyl)-2,4-dihydropyrimidine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 23643261 |
| Molecular Formula | C22H22F2N2O4 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | diethyl 1,3-bis(4-fluorophenyl)-2,4-dihydropyrimidine-5,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N(c2ccc(F)cc2)CN(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H22F2N2O4/c1-3-29-21(27)19-13-25(17-9-5-15(23)6-10-17)14-26(20(19)22(28)30-4-2)18-11-7-16(24)8-12-18/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | NRLCPYXQIPUTLZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |