C18H24O3 — CID 23643424
(4aR,10aS)-6-hydroxy-7-methoxy-1,1,4a-trimethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one (PubChem CID 23643424) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (4aR,10aS)-6-hydroxy-7-methoxy-1,1,4a-trimethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one.
| Compound Name | (4aR,10aS)-6-hydroxy-7-methoxy-1,1,4a-trimethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 23643424 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (4aR,10aS)-6-hydroxy-7-methoxy-1,1,4a-trimethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one |
| SMILES | COc1cc2c(cc1O)[C@]1(C)CCC(=O)C(C)(C)[C@H]1CC2 |
| InChI | InChI=1S/C18H24O3/c1-17(2)15-6-5-11-9-14(21-4)13(19)10-12(11)18(15,3)8-7-16(17)20/h9-10,15,19H,5-8H2,1-4H3/t15-,18+/m1/s1 |
| InChIKey | XCOMGNFQNSBISU-QAPCUYQASA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |