C8H15N2O5P — CID 23643429
[(3R,4R,5S)-4-acetamido-5-amino-3-hydroxycyclohexen-1-yl]phosphonic acid (PubChem CID 23643429) has the molecular formula C8H15N2O5P and a molecular weight of 250.19 g/mol. Its IUPAC name is [(3R,4R,5S)-4-acetamido-5-amino-3-hydroxycyclohexen-1-yl]phosphonic acid.
| Compound Name | [(3R,4R,5S)-4-acetamido-5-amino-3-hydroxycyclohexen-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 23643429 |
| Molecular Formula | C8H15N2O5P |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | [(3R,4R,5S)-4-acetamido-5-amino-3-hydroxycyclohexen-1-yl]phosphonic acid |
| SMILES | CC(=O)N[C@H]1[C@H](O)C=C(P(=O)(O)O)C[C@@H]1N |
| InChI | InChI=1S/C8H15N2O5P/c1-4(11)10-8-6(9)2-5(3-7(8)12)16(13,14)15/h3,6-8,12H,2,9H2,1H3,(H,10,11)(H2,13,14,15)/t6-,7+,8+/m0/s1 |
| InChIKey | WWXFTRQLPBVTRX-XLPZGREQSA-N |
| XLogP | -1.36 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|