C15H22O6 — CID 23643718
[(R)-[(1R,2S,6R,7S)-2,6-dimethyl-3,5-dioxo-10-oxabicyclo[5.2.1]decan-2-yl]-methoxymethyl] acetate (PubChem CID 23643718) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is [(R)-[(1R,2S,6R,7S)-2,6-dimethyl-3,5-dioxo-10-oxabicyclo[5.2.1]decan-2-yl]-methoxymethyl] acetate.
| Compound Name | [(R)-[(1R,2S,6R,7S)-2,6-dimethyl-3,5-dioxo-10-oxabicyclo[5.2.1]decan-2-yl]-methoxymethyl] acetate |
|---|---|
| PubChem CID | 23643718 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [(R)-[(1R,2S,6R,7S)-2,6-dimethyl-3,5-dioxo-10-oxabicyclo[5.2.1]decan-2-yl]-methoxymethyl] acetate |
| SMILES | CO[C@H](OC(C)=O)[C@@]1(C)C(=O)CC(=O)[C@H](C)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C15H22O6/c1-8-10(17)7-12(18)15(3,13-6-5-11(8)21-13)14(19-4)20-9(2)16/h8,11,13-14H,5-7H2,1-4H3/t8-,11-,13+,14+,15-/m0/s1 |
| InChIKey | GCVHMDWZOZUUIL-FQWSUXQDSA-N |
| XLogP | 1.25 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|