C18H34O5Si — CID 23643804
ethyl 2-[(2S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-6-hydroxy-2-methyloxan-2-yl]acetate (PubChem CID 23643804) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is ethyl 2-[(2S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-6-hydroxy-2-methyloxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-6-hydroxy-2-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 23643804 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | ethyl 2-[(2S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-6-hydroxy-2-methyloxan-2-yl]acetate |
| SMILES | C=C[C@H]1C[C@@](C)(CC(=O)OCC)OC(O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O5Si/c1-9-13-11-18(6,12-14(19)21-10-2)22-16(20)15(13)23-24(7,8)17(3,4)5/h9,13,15-16,20H,1,10-12H2,2-8H3/t13-,15-,16?,18-/m0/s1 |
| InChIKey | ARGJZJTZDRSQQF-VYDSJUIPSA-N |
| XLogP | 3.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|