C36H42N4 — CID 23643835
(2R,4R,5Z,12S,13Z,16Z)-25-(9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,13,16,25-tetraene (PubChem CID 23643835) has the molecular formula C36H42N4 and a molecular weight of 530.76 g/mol. Its IUPAC name is (2R,4R,5Z,12S,13Z,16Z)-25-(9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,13,16,25-tetraene.
| Compound Name | (2R,4R,5Z,12S,13Z,16Z)-25-(9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,13,16,25-tetraene |
|---|---|
| PubChem CID | 23643835 |
| Molecular Formula | C36H42N4 |
| Molecular Weight | 530.76 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | (2R,4R,5Z,12S,13Z,16Z)-25-(9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,13,16,25-tetraene |
| SMILES | C1=C(c2nccc3c2[nH]c2ccccc23)C2CCN3CCCC/C=C\C/C=C/1[C@@H]1N4CCCC/C=C\[C@H]4C[C@]21C3 |
| InChI | InChI=1S/C36H42N4/c1-2-5-11-20-39-22-18-31-30(33-34-29(17-19-37-33)28-15-9-10-16-32(28)38-34)23-26(13-7-3-1)35-36(31,25-39)24-27-14-8-4-6-12-21-40(27)35/h1,3,8-10,13-17,19,23,27,31,35,38H,2,4-7,11-12,18,20-22,24-25H2/b3-1-,14-8-,26-13+/t27-,31?,35-,36-/m0/s1 |
| InChIKey | XJPQQKQCGFEXKO-BPQUEZSKSA-N |
| XLogP | 7.66 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.76 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|