C15H26O3 — CID 23643842
[(2R,5S,8S,8aS)-2,4-bis(hydroxymethyl)-2,8-dimethyl-3,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]methanol (PubChem CID 23643842) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is [(2R,5S,8S,8aS)-2,4-bis(hydroxymethyl)-2,8-dimethyl-3,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]methanol.
| Compound Name | [(2R,5S,8S,8aS)-2,4-bis(hydroxymethyl)-2,8-dimethyl-3,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]methanol |
|---|---|
| PubChem CID | 23643842 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | [(2R,5S,8S,8aS)-2,4-bis(hydroxymethyl)-2,8-dimethyl-3,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]methanol |
| SMILES | C[C@H]1CC[C@H](CO)C(CO)=C2C[C@](C)(CO)C[C@H]21 |
| InChI | InChI=1S/C15H26O3/c1-10-3-4-11(7-16)14(8-17)13-6-15(2,9-18)5-12(10)13/h10-12,16-18H,3-9H2,1-2H3/t10-,11+,12-,15+/m0/s1 |
| InChIKey | OVEMDSHJDSVUAE-OZTPJHRESA-N |
| XLogP | 1.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|