About (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one
(6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one (PubChem CID 23643948) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one.
Molecular Properties
| Compound Name | (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one |
| PubChem CID | 23643948 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one |
| SMILES | C/C=C/C=C/C(=O)CCCCOC1CCCCO1 |
| InChI | InChI=1S/C15H24O3/c1-2-3-4-9-14(16)10-5-7-12-17-15-11-6-8-13-18-15/h2-4,9,15H,5-8,10-13H2,1H3/b3-2+,9-4+ |
| InChIKey | NTKQSKXRRCANPJ-DSXPNFDZSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one?
The IUPAC name of (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one (CID 23643948) is (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one.
What is the SMILES notation for (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one?
The canonical SMILES for (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one is C/C=C/C=C/C(=O)CCCCOC1CCCCO1.
What is the InChIKey of (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one?
The InChIKey is NTKQSKXRRCANPJ-DSXPNFDZSA-N. The full InChI is InChI=1S/C15H24O3/c1-2-3-4-9-14(16)10-5-7-12-17-15-11-6-8-13-18-15/h2-4,9,15H,5-8,10-13H2,1H3/b3-2+,9-4+.
What are the key properties of (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one?
(6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one has a molecular weight of 252.35 g/mol, XLogP of 3.40, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6E,8E)-1-(oxan-2-yloxy)deca-6,8-dien-5-one is sourced from PubChem (CID 23643948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).