About (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one
(2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one (PubChem CID 23643949) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one.
Molecular Properties
| Compound Name | (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one |
| PubChem CID | 23643949 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one |
| SMILES | C/C=C/C=C/C(=O)CCCCCOC1CCCCO1 |
| InChI | InChI=1S/C16H26O3/c1-2-3-5-10-15(17)11-6-4-8-13-18-16-12-7-9-14-19-16/h2-3,5,10,16H,4,6-9,11-14H2,1H3/b3-2+,10-5+ |
| InChIKey | GHZIGWXUCLIAIR-XPQLPGEHSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one?
The IUPAC name of (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one (CID 23643949) is (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one.
What is the SMILES notation for (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one?
The canonical SMILES for (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one is C/C=C/C=C/C(=O)CCCCCOC1CCCCO1.
What is the InChIKey of (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one?
The InChIKey is GHZIGWXUCLIAIR-XPQLPGEHSA-N. The full InChI is InChI=1S/C16H26O3/c1-2-3-5-10-15(17)11-6-4-8-13-18-16-12-7-9-14-19-16/h2-3,5,10,16H,4,6-9,11-14H2,1H3/b3-2+,10-5+.
What are the key properties of (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one?
(2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one has a molecular weight of 266.38 g/mol, XLogP of 3.79, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-11-(oxan-2-yloxy)undeca-2,4-dien-6-one is sourced from PubChem (CID 23643949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).