C22H26N2O3S — CID 23643997
N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]pyrrolidine-2-carboxamide (PubChem CID 23643997) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23643997 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-yl]pyrrolidine-2-carboxamide |
| SMILES | O=C(N[C@H](/C=C/S(=O)(=O)c1ccccc1)CCc1ccccc1)C1CCCN1 |
| InChI | InChI=1S/C22H26N2O3S/c25-22(21-12-7-16-23-21)24-19(14-13-18-8-3-1-4-9-18)15-17-28(26,27)20-10-5-2-6-11-20/h1-6,8-11,15,17,19,21,23H,7,12-14,16H2,(H,24,25)/b17-15+/t19-,21?/m0/s1 |
| InChIKey | BGTATSBYSPZUSB-BNWRYQNMSA-N |
| XLogP | 2.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |