About 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid
3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid (PubChem CID 23644405) has the molecular formula C7H9FO5
and a molecular weight of 192.14 g/mol. Its IUPAC name is 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid |
| PubChem CID | 23644405 |
| Molecular Formula | C7H9FO5 |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid |
| SMILES | O=C(O)C1(O)C=C(F)C(O)C(O)C1 |
| InChI | InChI=1S/C7H9FO5/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h1,4-5,9-10,13H,2H2,(H,11,12) |
| InChIKey | DGZQZSSRYAJDAX-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid?
The IUPAC name of 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid (CID 23644405) is 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid.
What is the SMILES notation for 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid?
The canonical SMILES for 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid is O=C(O)C1(O)C=C(F)C(O)C(O)C1.
What is the InChIKey of 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid?
The InChIKey is DGZQZSSRYAJDAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FO5/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h1,4-5,9-10,13H,2H2,(H,11,12).
What are the key properties of 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid?
3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid has a molecular weight of 192.14 g/mol, XLogP of -1.22, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1,4,5-trihydroxycyclohex-2-ene-1-carboxylic acid is sourced from PubChem (CID 23644405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).