About (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid
(2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid (PubChem CID 23644579) has the molecular formula C9H9FO4
and a molecular weight of 200.16 g/mol. Its IUPAC name is (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid.
Molecular Properties
| Compound Name | (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid |
| PubChem CID | 23644579 |
| Molecular Formula | C9H9FO4 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H9FO4/c10-6-3-1-5(2-4-6)7(11)8(12)9(13)14/h1-4,7-8,11-12H,(H,13,14)/t7-,8-/m0/s1 |
| InChIKey | DWYLYIVEFVSGCP-YUMQZZPRSA-N |
| XLogP | 0.30 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid?
The IUPAC name of (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid (CID 23644579) is (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid.
What is the SMILES notation for (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid?
The canonical SMILES for (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid is O=C(O)[C@@H](O)[C@@H](O)c1ccc(F)cc1.
What is the InChIKey of (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid?
The InChIKey is DWYLYIVEFVSGCP-YUMQZZPRSA-N. The full InChI is InChI=1S/C9H9FO4/c10-6-3-1-5(2-4-6)7(11)8(12)9(13)14/h1-4,7-8,11-12H,(H,13,14)/t7-,8-/m0/s1.
What are the key properties of (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid?
(2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid has a molecular weight of 200.16 g/mol, XLogP of 0.30, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoic acid is sourced from PubChem (CID 23644579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).