C46H48N2O4 — CID 23644610
(2R,4S)-2-[(4-benzylphenyl)methyl]-5-[(3S,5R)-3,5-dibenzyl-2-oxopyrrolidin-1-yl]-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide (PubChem CID 23644610) has the molecular formula C46H48N2O4 and a molecular weight of 692.90 g/mol. Its IUPAC name is (2R,4S)-2-[(4-benzylphenyl)methyl]-5-[(3S,5R)-3,5-dibenzyl-2-oxopyrrolidin-1-yl]-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide.
| Compound Name | (2R,4S)-2-[(4-benzylphenyl)methyl]-5-[(3S,5R)-3,5-dibenzyl-2-oxopyrrolidin-1-yl]-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide |
|---|---|
| PubChem CID | 23644610 |
| Molecular Formula | C46H48N2O4 |
| Molecular Weight | 692.90 g/mol |
| Exact Mass | 692.36 |
| IUPAC Name | (2R,4S)-2-[(4-benzylphenyl)methyl]-5-[(3S,5R)-3,5-dibenzyl-2-oxopyrrolidin-1-yl]-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pentanamide |
| SMILES | O=C(N[C@H]1c2ccccc2C[C@H]1O)[C@H](Cc1ccc(Cc2ccccc2)cc1)C[C@H](O)CN1C(=O)[C@@H](Cc2ccccc2)C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C46H48N2O4/c49-41(31-48-40(27-34-16-8-3-9-17-34)28-39(46(48)52)26-33-14-6-2-7-15-33)29-38(45(51)47-44-42-19-11-10-18-37(42)30-43(44)50)25-36-22-20-35(21-23-36)24-32-12-4-1-5-13-32/h1-23,38-41,43-44,49-50H,24-31H2,(H,47,51)/t38-,39+,40+,41+,43-,44+/m1/s1 |
| InChIKey | IVNAENYCBHJUAM-DSGWVAJWSA-N |
| XLogP | 6.66 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.90 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |