C35H46N2O7 — CID 23644613
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(5Z)-2-oxo-14-phenyl-1-oxa-3-azacyclotetradec-5-en-3-yl]-1-phenylbutan-2-yl]carbamate (PubChem CID 23644613) has the molecular formula C35H46N2O7 and a molecular weight of 606.76 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(5Z)-2-oxo-14-phenyl-1-oxa-3-azacyclotetradec-5-en-3-yl]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(5Z)-2-oxo-14-phenyl-1-oxa-3-azacyclotetradec-5-en-3-yl]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 23644613 |
| Molecular Formula | C35H46N2O7 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.33 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(5Z)-2-oxo-14-phenyl-1-oxa-3-azacyclotetradec-5-en-3-yl]-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@H](O)CN1C/C=C\CCCCCCCC(c2ccccc2)OC1=O)O[C@H]1CO[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C35H46N2O7/c38-30(29(23-26-15-9-7-10-16-26)36-34(39)43-32-25-42-33-28(32)20-22-41-33)24-37-21-14-6-4-2-1-3-5-13-19-31(44-35(37)40)27-17-11-8-12-18-27/h6-12,14-18,28-33,38H,1-5,13,19-25H2,(H,36,39)/b14-6-/t28-,29-,30+,31?,32-,33+/m0/s1 |
| InChIKey | ATKGTYUGMFKFHM-WJKGLYSCSA-N |
| XLogP | 5.93 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|