C37H43Cl2N5 — CID 23644656
N'-[3-[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl)amino]propyl]-N-(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)-N'-methylpropane-1,3-diamine (PubChem CID 23644656) has the molecular formula C37H43Cl2N5 and a molecular weight of 628.69 g/mol. Its IUPAC name is N'-[3-[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl)amino]propyl]-N-(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)-N'-methylpropane-1,3-diamine.
| Compound Name | N'-[3-[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl)amino]propyl]-N-(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 23644656 |
| Molecular Formula | C37H43Cl2N5 |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 627.29 |
| IUPAC Name | N'-[3-[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-yl)amino]propyl]-N-(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)-N'-methylpropane-1,3-diamine |
| SMILES | CC1=CC2Cc3nc4cc(Cl)ccc4c(NCCCN(C)CCCNc4c5c(nc6cc(Cl)ccc46)CCCC5)c3C(C1)C2 |
| InChI | InChI=1S/C37H43Cl2N5/c1-23-17-24-19-25(18-23)35-34(20-24)43-33-22-27(39)10-12-30(33)37(35)41-14-6-16-44(2)15-5-13-40-36-28-7-3-4-8-31(28)42-32-21-26(38)9-11-29(32)36/h9-12,17,21-22,24-25H,3-8,13-16,18-20H2,1-2H3,(H,40,42)(H,41,43) |
| InChIKey | DLMKTWKCMCVAMJ-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|