C33H42N8O4S — CID 23644677
2-[5-(diaminomethylideneamino)-2-[[(2S)-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]-N-(2-phenylethyl)-1,3-thiazole-4-carboxamide (PubChem CID 23644677) has the molecular formula C33H42N8O4S and a molecular weight of 646.82 g/mol. Its IUPAC name is 2-[5-(diaminomethylideneamino)-2-[[(2S)-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]-N-(2-phenylethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[5-(diaminomethylideneamino)-2-[[(2S)-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]-N-(2-phenylethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 23644677 |
| Molecular Formula | C33H42N8O4S |
| Molecular Weight | 646.82 g/mol |
| Exact Mass | 646.30 |
| IUPAC Name | 2-[5-(diaminomethylideneamino)-2-[[(2S)-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]-N-(2-phenylethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)NC(CCCN=C(N)N)C(=O)c1nc(C(=O)NCCc2ccccc2)cs1 |
| InChI | InChI=1S/C33H42N8O4S/c1-36-25(20-23-12-6-3-7-13-23)32(45)41-19-9-15-27(41)30(44)39-24(14-8-17-38-33(34)35)28(42)31-40-26(21-46-31)29(43)37-18-16-22-10-4-2-5-11-22/h2-7,10-13,21,24-25,27,36H,8-9,14-20H2,1H3,(H,37,43)(H,39,44)(H4,34,35,38)/t24?,25-,27+/m1/s1 |
| InChIKey | NUZPYXWXEQRGQT-CVWIZFJUSA-N |
| XLogP | 1.66 |
| TPSA | 184.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.82 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|