C38H41N5O5S2 — CID 23644680
(2S)-N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-2-[[(2R)-2-(benzylsulfonylamino)-3-phenylpropanoyl]amino]-3-phenylpropanamide (PubChem CID 23644680) has the molecular formula C38H41N5O5S2 and a molecular weight of 711.91 g/mol. Its IUPAC name is (2S)-N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-2-[[(2R)-2-(benzylsulfonylamino)-3-phenylpropanoyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-2-[[(2R)-2-(benzylsulfonylamino)-3-phenylpropanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 23644680 |
| Molecular Formula | C38H41N5O5S2 |
| Molecular Weight | 711.91 g/mol |
| Exact Mass | 711.25 |
| IUPAC Name | (2S)-N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-2-[[(2R)-2-(benzylsulfonylamino)-3-phenylpropanoyl]amino]-3-phenylpropanamide |
| SMILES | NCCCCC(NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](Cc1ccccc1)NS(=O)(=O)Cc1ccccc1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C38H41N5O5S2/c39-23-13-12-21-31(35(44)38-42-30-20-10-11-22-34(30)49-38)40-36(45)32(24-27-14-4-1-5-15-27)41-37(46)33(25-28-16-6-2-7-17-28)43-50(47,48)26-29-18-8-3-9-19-29/h1-11,14-20,22,31-33,43H,12-13,21,23-26,39H2,(H,40,45)(H,41,46)/t31?,32-,33+/m0/s1 |
| InChIKey | BPLWKQREVDBESU-ADIDXWPESA-N |
| XLogP | 4.55 |
| TPSA | 160.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.91 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|