C36H41N5O9 — CID 23644689
2-[4-[2-acetamido-3-[[5-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid (PubChem CID 23644689) has the molecular formula C36H41N5O9 and a molecular weight of 687.75 g/mol. Its IUPAC name is 2-[4-[2-acetamido-3-[[5-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid.
| Compound Name | 2-[4-[2-acetamido-3-[[5-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid |
|---|---|
| PubChem CID | 23644689 |
| Molecular Formula | C36H41N5O9 |
| Molecular Weight | 687.75 g/mol |
| Exact Mass | 687.29 |
| IUPAC Name | 2-[4-[2-acetamido-3-[[5-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid |
| SMILES | CCc1cc(CC(NC(C)=O)C(=O)NCCCCC(=O)NC(Cc2ccccc2)C(N)=O)ccc1N(C(=O)C(=O)O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C36H41N5O9/c1-3-25-19-24(16-17-29(25)41(34(46)36(49)50)30-14-8-7-13-26(30)35(47)48)21-28(39-22(2)42)33(45)38-18-10-9-15-31(43)40-27(32(37)44)20-23-11-5-4-6-12-23/h4-8,11-14,16-17,19,27-28H,3,9-10,15,18,20-21H2,1-2H3,(H2,37,44)(H,38,45)(H,39,42)(H,40,43)(H,47,48)(H,49,50) |
| InChIKey | OUSQUOSIODLPFL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 225.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.75 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|