C33H43N5O10 — CID 23644693
2-[4-[2-acetamido-3-[[5-[[(1S)-5-amino-1-carboxypentyl]amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid (PubChem CID 23644693) has the molecular formula C33H43N5O10 and a molecular weight of 669.73 g/mol. Its IUPAC name is 2-[4-[2-acetamido-3-[[5-[[(1S)-5-amino-1-carboxypentyl]amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid.
| Compound Name | 2-[4-[2-acetamido-3-[[5-[[(1S)-5-amino-1-carboxypentyl]amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid |
|---|---|
| PubChem CID | 23644693 |
| Molecular Formula | C33H43N5O10 |
| Molecular Weight | 669.73 g/mol |
| Exact Mass | 669.30 |
| IUPAC Name | 2-[4-[2-acetamido-3-[[5-[[(1S)-5-amino-1-carboxypentyl]amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid |
| SMILES | CCc1cc(CC(NC(C)=O)C(=O)NCCCCC(=O)N[C@@H](CCCCN)C(=O)O)ccc1N(C(=O)C(=O)O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C33H43N5O10/c1-3-22-18-21(14-15-26(22)38(30(42)33(47)48)27-12-5-4-10-23(27)31(43)44)19-25(36-20(2)39)29(41)35-17-9-7-13-28(40)37-24(32(45)46)11-6-8-16-34/h4-5,10,12,14-15,18,24-25H,3,6-9,11,13,16-17,19,34H2,1-2H3,(H,35,41)(H,36,39)(H,37,40)(H,43,44)(H,45,46)(H,47,48)/t24-,25?/m0/s1 |
| InChIKey | GYUIZHLTJIPAIQ-SKCDSABHSA-N |
| XLogP | 1.73 |
| TPSA | 245.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.73 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|