C29H47N5O6 — CID 23644720
(1R,5S)-3-[2-[(2-acetamido-3-methylbutanoyl)amino]-3,3-dimethylbutanoyl]-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 23644720) has the molecular formula C29H47N5O6 and a molecular weight of 561.72 g/mol. Its IUPAC name is (1R,5S)-3-[2-[(2-acetamido-3-methylbutanoyl)amino]-3,3-dimethylbutanoyl]-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,5S)-3-[2-[(2-acetamido-3-methylbutanoyl)amino]-3,3-dimethylbutanoyl]-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 23644720 |
| Molecular Formula | C29H47N5O6 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.35 |
| IUPAC Name | (1R,5S)-3-[2-[(2-acetamido-3-methylbutanoyl)amino]-3,3-dimethylbutanoyl]-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(=O)NC(C(=O)NC(C(=O)N1C[C@H]2[C@@H](C1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C29H47N5O6/c1-14(2)20(31-15(3)35)25(38)33-23(28(4,5)6)27(40)34-13-17-19(29(17,7)8)21(34)26(39)32-18(22(36)24(30)37)12-16-10-9-11-16/h14,16-21,23H,9-13H2,1-8H3,(H2,30,37)(H,31,35)(H,32,39)(H,33,38)/t17-,18?,19-,20?,21?,23?/m0/s1 |
| InChIKey | MXKUJVFSHRQBEK-MDJKMVEMSA-N |
| XLogP | 0.89 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|