C32H51N3O3 — CID 23644729
(2R,4S,5S,7S)-5-amino-N-butyl-7-[[4-tert-butyl-3-(pyridin-4-ylmethoxy)phenyl]methyl]-4-hydroxy-2,8-dimethylnonanamide (PubChem CID 23644729) has the molecular formula C32H51N3O3 and a molecular weight of 525.78 g/mol. Its IUPAC name is (2R,4S,5S,7S)-5-amino-N-butyl-7-[[4-tert-butyl-3-(pyridin-4-ylmethoxy)phenyl]methyl]-4-hydroxy-2,8-dimethylnonanamide.
| Compound Name | (2R,4S,5S,7S)-5-amino-N-butyl-7-[[4-tert-butyl-3-(pyridin-4-ylmethoxy)phenyl]methyl]-4-hydroxy-2,8-dimethylnonanamide |
|---|---|
| PubChem CID | 23644729 |
| Molecular Formula | C32H51N3O3 |
| Molecular Weight | 525.78 g/mol |
| Exact Mass | 525.39 |
| IUPAC Name | (2R,4S,5S,7S)-5-amino-N-butyl-7-[[4-tert-butyl-3-(pyridin-4-ylmethoxy)phenyl]methyl]-4-hydroxy-2,8-dimethylnonanamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)C[C@H](Cc1ccc(C(C)(C)C)c(OCc2ccncc2)c1)C(C)C |
| InChI | InChI=1S/C32H51N3O3/c1-8-9-14-35-31(37)23(4)17-29(36)28(33)20-26(22(2)3)18-25-10-11-27(32(5,6)7)30(19-25)38-21-24-12-15-34-16-13-24/h10-13,15-16,19,22-23,26,28-29,36H,8-9,14,17-18,20-21,33H2,1-7H3,(H,35,37)/t23-,26+,28+,29+/m1/s1 |
| InChIKey | LHSZSZARRCCSIZ-FWDBPZADSA-N |
| XLogP | 5.79 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.78 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|