C30H34ClN5O3 — CID 23644784
N-[4-[2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethyl-methylamino]butyl]-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 23644784) has the molecular formula C30H34ClN5O3 and a molecular weight of 548.09 g/mol. Its IUPAC name is N-[4-[2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethyl-methylamino]butyl]-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[4-[2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethyl-methylamino]butyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 23644784 |
| Molecular Formula | C30H34ClN5O3 |
| Molecular Weight | 548.09 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | N-[4-[2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethyl-methylamino]butyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CN(CCCCNC(=O)CN1C(=O)c2ccccc2C1=O)CCNc1c2c(nc3cc(Cl)ccc13)CCCC2 |
| InChI | InChI=1S/C30H34ClN5O3/c1-35(16-7-6-14-32-27(37)19-36-29(38)21-8-2-3-9-22(21)30(36)39)17-15-33-28-23-10-4-5-11-25(23)34-26-18-20(31)12-13-24(26)28/h2-3,8-9,12-13,18H,4-7,10-11,14-17,19H2,1H3,(H,32,37)(H,33,34) |
| InChIKey | YGULXWMNDJFAQR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.09 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|