About 11H-indeno[1,2-b]quinoline-8,10-diamine
11H-indeno[1,2-b]quinoline-8,10-diamine (PubChem CID 23644790) has the molecular formula C16H13N3
and a molecular weight of 247.30 g/mol. Its IUPAC name is 11H-indeno[1,2-b]quinoline-8,10-diamine.
Molecular Properties
| Compound Name | 11H-indeno[1,2-b]quinoline-8,10-diamine |
| PubChem CID | 23644790 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 11H-indeno[1,2-b]quinoline-8,10-diamine |
| SMILES | Nc1ccc2nc3c(c(N)c2c1)Cc1ccccc1-3 |
| InChI | InChI=1S/C16H13N3/c17-10-5-6-14-12(8-10)15(18)13-7-9-3-1-2-4-11(9)16(13)19-14/h1-6,8H,7,17H2,(H2,18,19) |
| InChIKey | LQFCZURJKDQWHF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 11H-indeno[1,2-b]quinoline-8,10-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11H-indeno[1,2-b]quinoline-8,10-diamine?
The IUPAC name of 11H-indeno[1,2-b]quinoline-8,10-diamine (CID 23644790) is 11H-indeno[1,2-b]quinoline-8,10-diamine.
What is the SMILES notation for 11H-indeno[1,2-b]quinoline-8,10-diamine?
The canonical SMILES for 11H-indeno[1,2-b]quinoline-8,10-diamine is Nc1ccc2nc3c(c(N)c2c1)Cc1ccccc1-3.
What is the InChIKey of 11H-indeno[1,2-b]quinoline-8,10-diamine?
The InChIKey is LQFCZURJKDQWHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3/c17-10-5-6-14-12(8-10)15(18)13-7-9-3-1-2-4-11(9)16(13)19-14/h1-6,8H,7,17H2,(H2,18,19).
What are the key properties of 11H-indeno[1,2-b]quinoline-8,10-diamine?
11H-indeno[1,2-b]quinoline-8,10-diamine has a molecular weight of 247.30 g/mol, XLogP of 2.97, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11H-indeno[1,2-b]quinoline-8,10-diamine is sourced from PubChem (CID 23644790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).