About 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine
3-methoxy-11H-indeno[1,2-b]quinolin-10-amine (PubChem CID 23644794) has the molecular formula C17H14N2O
and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine.
Molecular Properties
| Compound Name | 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine |
| PubChem CID | 23644794 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine |
| SMILES | COc1ccc2c(c1)-c1nc3ccccc3c(N)c1C2 |
| InChI | InChI=1S/C17H14N2O/c1-20-11-7-6-10-8-14-16(18)12-4-2-3-5-15(12)19-17(14)13(10)9-11/h2-7,9H,8H2,1H3,(H2,18,19) |
| InChIKey | XCCWBTOIDNKQAT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine?
The IUPAC name of 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine (CID 23644794) is 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine.
What is the SMILES notation for 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine?
The canonical SMILES for 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine is COc1ccc2c(c1)-c1nc3ccccc3c(N)c1C2.
What is the InChIKey of 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine?
The InChIKey is XCCWBTOIDNKQAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O/c1-20-11-7-6-10-8-14-16(18)12-4-2-3-5-15(12)19-17(14)13(10)9-11/h2-7,9H,8H2,1H3,(H2,18,19).
What are the key properties of 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine?
3-methoxy-11H-indeno[1,2-b]quinolin-10-amine has a molecular weight of 262.31 g/mol, XLogP of 3.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-11H-indeno[1,2-b]quinolin-10-amine is sourced from PubChem (CID 23644794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).